C17H14F2O — CID 132577797
4,4-difluoro-3-(3-methylphenyl)-1-phenylbut-3-en-1-one (PubChem CID 132577797) has the molecular formula C17H14F2O and a molecular weight of 272.29 g/mol. Its IUPAC name is 4,4-difluoro-3-(3-methylphenyl)-1-phenylbut-3-en-1-one.
| Compound Name | 4,4-difluoro-3-(3-methylphenyl)-1-phenylbut-3-en-1-one |
|---|---|
| PubChem CID | 132577797 |
| Molecular Formula | C17H14F2O |
| Molecular Weight | 272.29 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 4,4-difluoro-3-(3-methylphenyl)-1-phenylbut-3-en-1-one |
| SMILES | Cc1cccc(C(CC(=O)c2ccccc2)=C(F)F)c1 |
| InChI | InChI=1S/C17H14F2O/c1-12-6-5-9-14(10-12)15(17(18)19)11-16(20)13-7-3-2-4-8-13/h2-10H,11H2,1H3 |
| InChIKey | VSJZMZPOMMEGEB-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.29 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |