C30H26FO4P — CID 175548493
(E)-4-bis(4-methylphenoxy)phosphoryl-4-fluoro-1,3-diphenylbut-3-en-1-one (PubChem CID 175548493) has the molecular formula C30H26FO4P and a molecular weight of 500.51 g/mol. Its IUPAC name is (E)-4-bis(4-methylphenoxy)phosphoryl-4-fluoro-1,3-diphenylbut-3-en-1-one.
| Compound Name | (E)-4-bis(4-methylphenoxy)phosphoryl-4-fluoro-1,3-diphenylbut-3-en-1-one |
|---|---|
| PubChem CID | 175548493 |
| Molecular Formula | C30H26FO4P |
| Molecular Weight | 500.51 g/mol |
| Exact Mass | 500.16 |
| IUPAC Name | (E)-4-bis(4-methylphenoxy)phosphoryl-4-fluoro-1,3-diphenylbut-3-en-1-one |
| SMILES | Cc1ccc(OP(=O)(Oc2ccc(C)cc2)/C(F)=C(\CC(=O)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C30H26FO4P/c1-22-13-17-26(18-14-22)34-36(33,35-27-19-15-23(2)16-20-27)30(31)28(24-9-5-3-6-10-24)21-29(32)25-11-7-4-8-12-25/h3-20H,21H2,1-2H3/b30-28+ |
| InChIKey | REZGIQQEFRVOKY-SJCQXOIGSA-N |
| XLogP | 8.57 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.51 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|