C28H25N2O4P — CID 6322700
(2E)-2-[bis(4-methylphenoxy)phosphorylhydrazinylidene]-1,2-diphenylethanone (PubChem CID 6322700) has the molecular formula C28H25N2O4P and a molecular weight of 484.49 g/mol. Its IUPAC name is (2E)-2-[bis(4-methylphenoxy)phosphorylhydrazinylidene]-1,2-diphenylethanone.
| Compound Name | (2E)-2-[bis(4-methylphenoxy)phosphorylhydrazinylidene]-1,2-diphenylethanone |
|---|---|
| PubChem CID | 6322700 |
| Molecular Formula | C28H25N2O4P |
| Molecular Weight | 484.49 g/mol |
| Exact Mass | 484.16 |
| IUPAC Name | (2E)-2-[bis(4-methylphenoxy)phosphorylhydrazinylidene]-1,2-diphenylethanone |
| SMILES | Cc1ccc(OP(=O)(N/N=C(/C(=O)c2ccccc2)c2ccccc2)Oc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C28H25N2O4P/c1-21-13-17-25(18-14-21)33-35(32,34-26-19-15-22(2)16-20-26)30-29-27(23-9-5-3-6-10-23)28(31)24-11-7-4-8-12-24/h3-20H,1-2H3,(H,30,32)/b29-27+ |
| InChIKey | OWVGIMMYTNDXHE-ORIPQNMZSA-N |
| XLogP | 6.75 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.49 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|