C21H17ClN2O — CID 3415921
2-[(3-chloro-4-methylphenyl)hydrazinylidene]-1,2-diphenylethanone (PubChem CID 3415921) has the molecular formula C21H17ClN2O and a molecular weight of 348.83 g/mol. Its IUPAC name is 2-[(3-chloro-4-methylphenyl)hydrazinylidene]-1,2-diphenylethanone.
| Compound Name | 2-[(3-chloro-4-methylphenyl)hydrazinylidene]-1,2-diphenylethanone |
|---|---|
| PubChem CID | 3415921 |
| Molecular Formula | C21H17ClN2O |
| Molecular Weight | 348.83 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | 2-[(3-chloro-4-methylphenyl)hydrazinylidene]-1,2-diphenylethanone |
| SMILES | Cc1ccc(NN=C(C(=O)c2ccccc2)c2ccccc2)cc1Cl |
| InChI | InChI=1S/C21H17ClN2O/c1-15-12-13-18(14-19(15)22)23-24-20(16-8-4-2-5-9-16)21(25)17-10-6-3-7-11-17/h2-14,23H,1H3 |
| InChIKey | KNTHWSKREXJXKU-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.83 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|