C18H20ClN3O4S — CID 9069189
3-[[3-[(Z)-N-(3-chloro-4-methylanilino)-C-methylcarbonimidoyl]phenyl]sulfonylamino]propanoic acid (PubChem CID 9069189) has the molecular formula C18H20ClN3O4S and a molecular weight of 409.90 g/mol. Its IUPAC name is 3-[[3-[(Z)-N-(3-chloro-4-methylanilino)-C-methylcarbonimidoyl]phenyl]sulfonylamino]propanoic acid.
| Compound Name | 3-[[3-[(Z)-N-(3-chloro-4-methylanilino)-C-methylcarbonimidoyl]phenyl]sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 9069189 |
| Molecular Formula | C18H20ClN3O4S |
| Molecular Weight | 409.90 g/mol |
| Exact Mass | 409.09 |
| IUPAC Name | 3-[[3-[(Z)-N-(3-chloro-4-methylanilino)-C-methylcarbonimidoyl]phenyl]sulfonylamino]propanoic acid |
| SMILES | C/C(=N/Nc1ccc(C)c(Cl)c1)c1cccc(S(=O)(=O)NCCC(=O)O)c1 |
| InChI | InChI=1S/C18H20ClN3O4S/c1-12-6-7-15(11-17(12)19)22-21-13(2)14-4-3-5-16(10-14)27(25,26)20-9-8-18(23)24/h3-7,10-11,20,22H,8-9H2,1-2H3,(H,23,24)/b21-13- |
| InChIKey | DAPOKEQYZNPYDU-BKUYFWCQSA-N |
| XLogP | 3.24 |
| TPSA | 107.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.90 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|