C19H23ClN4O2S — CID 9069268
3-chloro-4-methyl-N-[(Z)-1-(4-piperazin-1-ylsulfonylphenyl)ethylideneamino]aniline (PubChem CID 9069268) has the molecular formula C19H23ClN4O2S and a molecular weight of 406.94 g/mol. Its IUPAC name is 3-chloro-4-methyl-N-[(Z)-1-(4-piperazin-1-ylsulfonylphenyl)ethylideneamino]aniline.
| Compound Name | 3-chloro-4-methyl-N-[(Z)-1-(4-piperazin-1-ylsulfonylphenyl)ethylideneamino]aniline |
|---|---|
| PubChem CID | 9069268 |
| Molecular Formula | C19H23ClN4O2S |
| Molecular Weight | 406.94 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | 3-chloro-4-methyl-N-[(Z)-1-(4-piperazin-1-ylsulfonylphenyl)ethylideneamino]aniline |
| SMILES | C/C(=N/Nc1ccc(C)c(Cl)c1)c1ccc(S(=O)(=O)N2CCNCC2)cc1 |
| InChI | InChI=1S/C19H23ClN4O2S/c1-14-3-6-17(13-19(14)20)23-22-15(2)16-4-7-18(8-5-16)27(25,26)24-11-9-21-10-12-24/h3-8,13,21,23H,9-12H2,1-2H3/b22-15- |
| InChIKey | GRANSWBCHPCDFM-JCMHNJIXSA-N |
| XLogP | 3.08 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.94 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|