C22H24ClN3O6S — CID 43029839
[2-(3-chloro-4-methylanilino)-2-oxoethyl] 4-(4-acetylpiperazin-1-yl)sulfonylbenzoate (PubChem CID 43029839) has the molecular formula C22H24ClN3O6S and a molecular weight of 493.97 g/mol. Its IUPAC name is [2-(3-chloro-4-methylanilino)-2-oxoethyl] 4-(4-acetylpiperazin-1-yl)sulfonylbenzoate.
| Compound Name | [2-(3-chloro-4-methylanilino)-2-oxoethyl] 4-(4-acetylpiperazin-1-yl)sulfonylbenzoate |
|---|---|
| PubChem CID | 43029839 |
| Molecular Formula | C22H24ClN3O6S |
| Molecular Weight | 493.97 g/mol |
| Exact Mass | 493.11 |
| IUPAC Name | [2-(3-chloro-4-methylanilino)-2-oxoethyl] 4-(4-acetylpiperazin-1-yl)sulfonylbenzoate |
| SMILES | CC(=O)N1CCN(S(=O)(=O)c2ccc(C(=O)OCC(=O)Nc3ccc(C)c(Cl)c3)cc2)CC1 |
| InChI | InChI=1S/C22H24ClN3O6S/c1-15-3-6-18(13-20(15)23)24-21(28)14-32-22(29)17-4-7-19(8-5-17)33(30,31)26-11-9-25(10-12-26)16(2)27/h3-8,13H,9-12,14H2,1-2H3,(H,24,28) |
| InChIKey | MKRBDHWNRYZHDE-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.97 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |