C18H23N5O2S — CID 40882052
4,6-dimethyl-N-[(Z)-1-(4-pyrrolidin-1-ylsulfonylphenyl)ethylideneamino]pyrimidin-2-amine (PubChem CID 40882052) has the molecular formula C18H23N5O2S and a molecular weight of 373.48 g/mol. Its IUPAC name is 4,6-dimethyl-N-[(Z)-1-(4-pyrrolidin-1-ylsulfonylphenyl)ethylideneamino]pyrimidin-2-amine.
| Compound Name | 4,6-dimethyl-N-[(Z)-1-(4-pyrrolidin-1-ylsulfonylphenyl)ethylideneamino]pyrimidin-2-amine |
|---|---|
| PubChem CID | 40882052 |
| Molecular Formula | C18H23N5O2S |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | 4,6-dimethyl-N-[(Z)-1-(4-pyrrolidin-1-ylsulfonylphenyl)ethylideneamino]pyrimidin-2-amine |
| SMILES | C/C(=N/Nc1nc(C)cc(C)n1)c1ccc(S(=O)(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C18H23N5O2S/c1-13-12-14(2)20-18(19-13)22-21-15(3)16-6-8-17(9-7-16)26(24,25)23-10-4-5-11-23/h6-9,12H,4-5,10-11H2,1-3H3,(H,19,20,22)/b21-15- |
| InChIKey | BCFOYTIGISXMBC-QNGOZBTKSA-N |
| XLogP | 2.71 |
| TPSA | 87.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|