C23H16F5O2P — CID 132521363
1-(4-diphenylphosphanylphenyl)-4,4,5,5,5-pentafluoropentane-1,3-dione (PubChem CID 132521363) has the molecular formula C23H16F5O2P and a molecular weight of 450.34 g/mol. Its IUPAC name is 1-(4-diphenylphosphanylphenyl)-4,4,5,5,5-pentafluoropentane-1,3-dione.
| Compound Name | 1-(4-diphenylphosphanylphenyl)-4,4,5,5,5-pentafluoropentane-1,3-dione |
|---|---|
| PubChem CID | 132521363 |
| Molecular Formula | C23H16F5O2P |
| Molecular Weight | 450.34 g/mol |
| Exact Mass | 450.08 |
| IUPAC Name | 1-(4-diphenylphosphanylphenyl)-4,4,5,5,5-pentafluoropentane-1,3-dione |
| SMILES | O=C(CC(=O)C(F)(F)C(F)(F)F)c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H16F5O2P/c24-22(25,23(26,27)28)21(30)15-20(29)16-11-13-19(14-12-16)31(17-7-3-1-4-8-17)18-9-5-2-6-10-18/h1-14H,15H2 |
| InChIKey | UEFYRPMSPTZWLS-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.34 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|