C11H5F7O2 — CID 12588959
1-(3,4-difluorophenyl)-4,4,5,5,5-pentafluoropentane-1,3-dione (PubChem CID 12588959) has the molecular formula C11H5F7O2 and a molecular weight of 302.15 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-4,4,5,5,5-pentafluoropentane-1,3-dione.
| Compound Name | 1-(3,4-difluorophenyl)-4,4,5,5,5-pentafluoropentane-1,3-dione |
|---|---|
| PubChem CID | 12588959 |
| Molecular Formula | C11H5F7O2 |
| Molecular Weight | 302.15 g/mol |
| Exact Mass | 302.02 |
| IUPAC Name | 1-(3,4-difluorophenyl)-4,4,5,5,5-pentafluoropentane-1,3-dione |
| SMILES | O=C(CC(=O)C(F)(F)C(F)(F)F)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C11H5F7O2/c12-6-2-1-5(3-7(6)13)8(19)4-9(20)10(14,15)11(16,17)18/h1-3H,4H2 |
| InChIKey | ROEBUSAVIBYNMV-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.15 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|