C10H7F2NO3 — CID 91931208
4-(3,4-difluorophenyl)-2-imino-4-oxobutanoic acid (PubChem CID 91931208) has the molecular formula C10H7F2NO3 and a molecular weight of 227.17 g/mol. Its IUPAC name is 4-(3,4-difluorophenyl)-2-imino-4-oxobutanoic acid.
| Compound Name | 4-(3,4-difluorophenyl)-2-imino-4-oxobutanoic acid |
|---|---|
| PubChem CID | 91931208 |
| Molecular Formula | C10H7F2NO3 |
| Molecular Weight | 227.17 g/mol |
| Exact Mass | 227.04 |
| IUPAC Name | 4-(3,4-difluorophenyl)-2-imino-4-oxobutanoic acid |
| SMILES | [H]/N=C(/CC(=O)c1ccc(F)c(F)c1)C(=O)O |
| InChI | InChI=1S/C10H7F2NO3/c11-6-2-1-5(3-7(6)12)9(14)4-8(13)10(15)16/h1-3,13H,4H2,(H,15,16)/b13-8- |
| InChIKey | CNCSEDZIAJJORR-JYRVWZFOSA-N |
| XLogP | 1.64 |
| TPSA | 78.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.17 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|