C8H7F2NO2 — CID 18712701
(2Z)-2-(3,4-difluorophenyl)-2-hydroxyiminoethanol (PubChem CID 18712701) has the molecular formula C8H7F2NO2 and a molecular weight of 187.14 g/mol. Its IUPAC name is (2Z)-2-(3,4-difluorophenyl)-2-hydroxyiminoethanol.
| Compound Name | (2Z)-2-(3,4-difluorophenyl)-2-hydroxyiminoethanol |
|---|---|
| PubChem CID | 18712701 |
| Molecular Formula | C8H7F2NO2 |
| Molecular Weight | 187.14 g/mol |
| Exact Mass | 187.04 |
| IUPAC Name | (2Z)-2-(3,4-difluorophenyl)-2-hydroxyiminoethanol |
| SMILES | OC/C(=N\O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C8H7F2NO2/c9-6-2-1-5(3-7(6)10)8(4-12)11-13/h1-3,12-13H,4H2/b11-8+ |
| InChIKey | LNZSBWVRHYDBED-DHZHZOJOSA-N |
| XLogP | 1.14 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.14 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|