C14H8F4O2 — CID 43612522
2-(3,4-difluorophenoxy)-1-(3,4-difluorophenyl)ethanone (PubChem CID 43612522) has the molecular formula C14H8F4O2 and a molecular weight of 284.21 g/mol. Its IUPAC name is 2-(3,4-difluorophenoxy)-1-(3,4-difluorophenyl)ethanone.
| Compound Name | 2-(3,4-difluorophenoxy)-1-(3,4-difluorophenyl)ethanone |
|---|---|
| PubChem CID | 43612522 |
| Molecular Formula | C14H8F4O2 |
| Molecular Weight | 284.21 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | 2-(3,4-difluorophenoxy)-1-(3,4-difluorophenyl)ethanone |
| SMILES | O=C(COc1ccc(F)c(F)c1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C14H8F4O2/c15-10-3-1-8(5-12(10)17)14(19)7-20-9-2-4-11(16)13(18)6-9/h1-6H,7H2 |
| InChIKey | HJPPQWPOHWNYAN-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.21 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |