C12H8F2O2S — CID 43612539
2-(3,4-difluorophenoxy)-1-thiophen-2-ylethanone (PubChem CID 43612539) has the molecular formula C12H8F2O2S and a molecular weight of 254.26 g/mol. Its IUPAC name is 2-(3,4-difluorophenoxy)-1-thiophen-2-ylethanone.
| Compound Name | 2-(3,4-difluorophenoxy)-1-thiophen-2-ylethanone |
|---|---|
| PubChem CID | 43612539 |
| Molecular Formula | C12H8F2O2S |
| Molecular Weight | 254.26 g/mol |
| Exact Mass | 254.02 |
| IUPAC Name | 2-(3,4-difluorophenoxy)-1-thiophen-2-ylethanone |
| SMILES | O=C(COc1ccc(F)c(F)c1)c1cccs1 |
| InChI | InChI=1S/C12H8F2O2S/c13-9-4-3-8(6-10(9)14)16-7-11(15)12-2-1-5-17-12/h1-6H,7H2 |
| InChIKey | SKYZMCGPRVRPPA-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.26 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |