C14H9BrF2O2 — CID 43612513
1-(4-bromophenyl)-2-(3,4-difluorophenoxy)ethanone (PubChem CID 43612513) has the molecular formula C14H9BrF2O2 and a molecular weight of 327.12 g/mol. Its IUPAC name is 1-(4-bromophenyl)-2-(3,4-difluorophenoxy)ethanone.
| Compound Name | 1-(4-bromophenyl)-2-(3,4-difluorophenoxy)ethanone |
|---|---|
| PubChem CID | 43612513 |
| Molecular Formula | C14H9BrF2O2 |
| Molecular Weight | 327.12 g/mol |
| Exact Mass | 325.98 |
| IUPAC Name | 1-(4-bromophenyl)-2-(3,4-difluorophenoxy)ethanone |
| SMILES | O=C(COc1ccc(F)c(F)c1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C14H9BrF2O2/c15-10-3-1-9(2-4-10)14(18)8-19-11-5-6-12(16)13(17)7-11/h1-7H,8H2 |
| InChIKey | IRKOMAKTGFEXCK-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.12 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |