C17H10F5NO2 — CID 91160960
1-(9H-carbazol-2-yl)-4,4,5,5,5-pentafluoropentane-1,3-dione (PubChem CID 91160960) has the molecular formula C17H10F5NO2 and a molecular weight of 355.26 g/mol. Its IUPAC name is 1-(9H-carbazol-2-yl)-4,4,5,5,5-pentafluoropentane-1,3-dione.
| Compound Name | 1-(9H-carbazol-2-yl)-4,4,5,5,5-pentafluoropentane-1,3-dione |
|---|---|
| PubChem CID | 91160960 |
| Molecular Formula | C17H10F5NO2 |
| Molecular Weight | 355.26 g/mol |
| Exact Mass | 355.06 |
| IUPAC Name | 1-(9H-carbazol-2-yl)-4,4,5,5,5-pentafluoropentane-1,3-dione |
| SMILES | O=C(CC(=O)C(F)(F)C(F)(F)F)c1ccc2c(c1)[nH]c1ccccc12 |
| InChI | InChI=1S/C17H10F5NO2/c18-16(19,17(20,21)22)15(25)8-14(24)9-5-6-11-10-3-1-2-4-12(10)23-13(11)7-9/h1-7,23H,8H2 |
| InChIKey | SRDPHBVCVJRMHU-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.26 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|