C19H17Cl2NO3 — CID 24615468
[1-(2,4-dichlorobenzoyl)piperidin-4-yl]-(4-hydroxyphenyl)methanone (PubChem CID 24615468) has the molecular formula C19H17Cl2NO3 and a molecular weight of 378.25 g/mol. Its IUPAC name is [1-(2,4-dichlorobenzoyl)piperidin-4-yl]-(4-hydroxyphenyl)methanone.
| Compound Name | [1-(2,4-dichlorobenzoyl)piperidin-4-yl]-(4-hydroxyphenyl)methanone |
|---|---|
| PubChem CID | 24615468 |
| Molecular Formula | C19H17Cl2NO3 |
| Molecular Weight | 378.25 g/mol |
| Exact Mass | 377.06 |
| IUPAC Name | [1-(2,4-dichlorobenzoyl)piperidin-4-yl]-(4-hydroxyphenyl)methanone |
| SMILES | O=C(c1ccc(O)cc1)C1CCN(C(=O)c2ccc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C19H17Cl2NO3/c20-14-3-6-16(17(21)11-14)19(25)22-9-7-13(8-10-22)18(24)12-1-4-15(23)5-2-12/h1-6,11,13,23H,7-10H2 |
| InChIKey | BXDJROIZXWIXHM-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.25 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |