C25H21F3O4 — CID 118891407
(4-propylphenyl) 6-ethoxy-3,4,5-trifluoro-9H-xanthene-2-carboxylate (PubChem CID 118891407) has the molecular formula C25H21F3O4 and a molecular weight of 442.43 g/mol. Its IUPAC name is (4-propylphenyl) 6-ethoxy-3,4,5-trifluoro-9H-xanthene-2-carboxylate.
| Compound Name | (4-propylphenyl) 6-ethoxy-3,4,5-trifluoro-9H-xanthene-2-carboxylate |
|---|---|
| PubChem CID | 118891407 |
| Molecular Formula | C25H21F3O4 |
| Molecular Weight | 442.43 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | (4-propylphenyl) 6-ethoxy-3,4,5-trifluoro-9H-xanthene-2-carboxylate |
| SMILES | CCCc1ccc(OC(=O)c2cc3c(c(F)c2F)Oc2c(ccc(OCC)c2F)C3)cc1 |
| InChI | InChI=1S/C25H21F3O4/c1-3-5-14-6-9-17(10-7-14)31-25(29)18-13-16-12-15-8-11-19(30-4-2)21(27)23(15)32-24(16)22(28)20(18)26/h6-11,13H,3-5,12H2,1-2H3 |
| InChIKey | DDROZIBZJSYAQF-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.43 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|