C24H27F3O3 — CID 144734050
6-[(E)-2,5-dimethylhept-4-enoxy]-2-ethoxy-3,4,5-trifluoro-9H-xanthene (PubChem CID 144734050) has the molecular formula C24H27F3O3 and a molecular weight of 420.47 g/mol. Its IUPAC name is 6-[(E)-2,5-dimethylhept-4-enoxy]-2-ethoxy-3,4,5-trifluoro-9H-xanthene.
| Compound Name | 6-[(E)-2,5-dimethylhept-4-enoxy]-2-ethoxy-3,4,5-trifluoro-9H-xanthene |
|---|---|
| PubChem CID | 144734050 |
| Molecular Formula | C24H27F3O3 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | 6-[(E)-2,5-dimethylhept-4-enoxy]-2-ethoxy-3,4,5-trifluoro-9H-xanthene |
| SMILES | CCOc1cc2c(c(F)c1F)Oc1c(ccc(OCC(C)C/C=C(\C)CC)c1F)C2 |
| InChI | InChI=1S/C24H27F3O3/c1-5-14(3)7-8-15(4)13-29-18-10-9-16-11-17-12-19(28-6-2)20(25)22(27)24(17)30-23(16)21(18)26/h7,9-10,12,15H,5-6,8,11,13H2,1-4H3/b14-7+ |
| InChIKey | NGOBIUAVZJIWTN-VGOFMYFVSA-N |
| XLogP | 6.96 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|