C26H27F3O3 — CID 118891449
2-[(4-but-3-enylcyclohexen-1-yl)methoxy]-6-ethoxy-3,4,5-trifluoro-9H-xanthene (PubChem CID 118891449) has the molecular formula C26H27F3O3 and a molecular weight of 444.49 g/mol. Its IUPAC name is 2-[(4-but-3-enylcyclohexen-1-yl)methoxy]-6-ethoxy-3,4,5-trifluoro-9H-xanthene.
| Compound Name | 2-[(4-but-3-enylcyclohexen-1-yl)methoxy]-6-ethoxy-3,4,5-trifluoro-9H-xanthene |
|---|---|
| PubChem CID | 118891449 |
| Molecular Formula | C26H27F3O3 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | 2-[(4-but-3-enylcyclohexen-1-yl)methoxy]-6-ethoxy-3,4,5-trifluoro-9H-xanthene |
| SMILES | C=CCCC1CC=C(COc2cc3c(c(F)c2F)Oc2c(ccc(OCC)c2F)C3)CC1 |
| InChI | InChI=1S/C26H27F3O3/c1-3-5-6-16-7-9-17(10-8-16)15-31-21-14-19-13-18-11-12-20(30-4-2)23(28)25(18)32-26(19)24(29)22(21)27/h3,9,11-12,14,16H,1,4-8,10,13,15H2,2H3 |
| InChIKey | SGJSQQFXAOMMFU-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|