C30H31F4N — CID 139817654
6-[2,6-difluoro-4-[2-(4-pentylcyclohexyl)ethyl]phenyl]-1,3-difluoronaphthalene-2-carbonitrile (PubChem CID 139817654) has the molecular formula C30H31F4N and a molecular weight of 481.58 g/mol. Its IUPAC name is 6-[2,6-difluoro-4-[2-(4-pentylcyclohexyl)ethyl]phenyl]-1,3-difluoronaphthalene-2-carbonitrile.
| Compound Name | 6-[2,6-difluoro-4-[2-(4-pentylcyclohexyl)ethyl]phenyl]-1,3-difluoronaphthalene-2-carbonitrile |
|---|---|
| PubChem CID | 139817654 |
| Molecular Formula | C30H31F4N |
| Molecular Weight | 481.58 g/mol |
| Exact Mass | 481.24 |
| IUPAC Name | 6-[2,6-difluoro-4-[2-(4-pentylcyclohexyl)ethyl]phenyl]-1,3-difluoronaphthalene-2-carbonitrile |
| SMILES | CCCCCC1CCC(CCc2cc(F)c(-c3ccc4c(F)c(C#N)c(F)cc4c3)c(F)c2)CC1 |
| InChI | InChI=1S/C30H31F4N/c1-2-3-4-5-19-6-8-20(9-7-19)10-11-21-14-27(32)29(28(33)15-21)22-12-13-24-23(16-22)17-26(31)25(18-35)30(24)34/h12-17,19-20H,2-11H2,1H3 |
| InChIKey | NJTAFTAOLYEIAC-UHFFFAOYSA-N |
| XLogP | 9.25 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.58 |
| LogP ≤ 5 | 9.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|