C21H27F3O — CID 139948942
2-[2-(4-ethylcyclohexyl)ethyl]-6-(trifluoromethoxy)-1,4-dihydronaphthalene (PubChem CID 139948942) has the molecular formula C21H27F3O and a molecular weight of 352.44 g/mol. Its IUPAC name is 2-[2-(4-ethylcyclohexyl)ethyl]-6-(trifluoromethoxy)-1,4-dihydronaphthalene.
| Compound Name | 2-[2-(4-ethylcyclohexyl)ethyl]-6-(trifluoromethoxy)-1,4-dihydronaphthalene |
|---|---|
| PubChem CID | 139948942 |
| Molecular Formula | C21H27F3O |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | 2-[2-(4-ethylcyclohexyl)ethyl]-6-(trifluoromethoxy)-1,4-dihydronaphthalene |
| SMILES | CCC1CCC(CCC2=CCc3cc(OC(F)(F)F)ccc3C2)CC1 |
| InChI | InChI=1S/C21H27F3O/c1-2-15-3-5-16(6-4-15)7-8-17-9-10-19-14-20(25-21(22,23)24)12-11-18(19)13-17/h9,11-12,14-16H,2-8,10,13H2,1H3 |
| InChIKey | SHIBNPHTHCPCRV-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|