C23H30F4O — CID 139961768
2-[2-(4-butylcyclohexyl)ethyl]-7-fluoro-6-(trifluoromethoxy)-1,4-dihydronaphthalene (PubChem CID 139961768) has the molecular formula C23H30F4O and a molecular weight of 398.48 g/mol. Its IUPAC name is 2-[2-(4-butylcyclohexyl)ethyl]-7-fluoro-6-(trifluoromethoxy)-1,4-dihydronaphthalene.
| Compound Name | 2-[2-(4-butylcyclohexyl)ethyl]-7-fluoro-6-(trifluoromethoxy)-1,4-dihydronaphthalene |
|---|---|
| PubChem CID | 139961768 |
| Molecular Formula | C23H30F4O |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | 2-[2-(4-butylcyclohexyl)ethyl]-7-fluoro-6-(trifluoromethoxy)-1,4-dihydronaphthalene |
| SMILES | CCCCC1CCC(CCC2=CCc3cc(OC(F)(F)F)c(F)cc3C2)CC1 |
| InChI | InChI=1S/C23H30F4O/c1-2-3-4-16-5-7-17(8-6-16)9-10-18-11-12-19-15-22(28-23(25,26)27)21(24)14-20(19)13-18/h11,14-17H,2-10,12-13H2,1H3 |
| InChIKey | SVVZTQILTPHOIO-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|