C28H31F5O — CID 139948720
2-[4-(2,6-difluoro-4-pentylcyclohexyl)phenyl]-6-(trifluoromethoxy)-1,4-dihydronaphthalene (PubChem CID 139948720) has the molecular formula C28H31F5O and a molecular weight of 478.55 g/mol. Its IUPAC name is 2-[4-(2,6-difluoro-4-pentylcyclohexyl)phenyl]-6-(trifluoromethoxy)-1,4-dihydronaphthalene.
| Compound Name | 2-[4-(2,6-difluoro-4-pentylcyclohexyl)phenyl]-6-(trifluoromethoxy)-1,4-dihydronaphthalene |
|---|---|
| PubChem CID | 139948720 |
| Molecular Formula | C28H31F5O |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.23 |
| IUPAC Name | 2-[4-(2,6-difluoro-4-pentylcyclohexyl)phenyl]-6-(trifluoromethoxy)-1,4-dihydronaphthalene |
| SMILES | CCCCCC1CC(F)C(c2ccc(C3=CCc4cc(OC(F)(F)F)ccc4C3)cc2)C(F)C1 |
| InChI | InChI=1S/C28H31F5O/c1-2-3-4-5-18-14-25(29)27(26(30)15-18)20-8-6-19(7-9-20)21-10-11-23-17-24(34-28(31,32)33)13-12-22(23)16-21/h6-10,12-13,17-18,25-27H,2-5,11,14-16H2,1H3 |
| InChIKey | RGSKDJYSEDATIC-UHFFFAOYSA-N |
| XLogP | 8.52 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|