C28H30F6O — CID 139948737
5,7-difluoro-6-[3-fluoro-4-(trifluoromethoxy)phenyl]-2-(4-pentylcyclohexyl)-1,4-dihydronaphthalene (PubChem CID 139948737) has the molecular formula C28H30F6O and a molecular weight of 496.54 g/mol. Its IUPAC name is 5,7-difluoro-6-[3-fluoro-4-(trifluoromethoxy)phenyl]-2-(4-pentylcyclohexyl)-1,4-dihydronaphthalene.
| Compound Name | 5,7-difluoro-6-[3-fluoro-4-(trifluoromethoxy)phenyl]-2-(4-pentylcyclohexyl)-1,4-dihydronaphthalene |
|---|---|
| PubChem CID | 139948737 |
| Molecular Formula | C28H30F6O |
| Molecular Weight | 496.54 g/mol |
| Exact Mass | 496.22 |
| IUPAC Name | 5,7-difluoro-6-[3-fluoro-4-(trifluoromethoxy)phenyl]-2-(4-pentylcyclohexyl)-1,4-dihydronaphthalene |
| SMILES | CCCCCC1CCC(C2=CCc3c(cc(F)c(-c4ccc(OC(F)(F)F)c(F)c4)c3F)C2)CC1 |
| InChI | InChI=1S/C28H30F6O/c1-2-3-4-5-17-6-8-18(9-7-17)19-10-12-22-21(14-19)16-24(30)26(27(22)31)20-11-13-25(23(29)15-20)35-28(32,33)34/h10-11,13,15-18H,2-9,12,14H2,1H3 |
| InChIKey | IYRHCVJDFXDDKO-UHFFFAOYSA-N |
| XLogP | 9.08 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.54 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|