C30H34F6O — CID 139952091
6,8-difluoro-7-[3-fluoro-4-(trifluoromethoxy)phenyl]-3-[2-(4-pentylcyclohexyl)ethyl]-1,2-dihydronaphthalene (PubChem CID 139952091) has the molecular formula C30H34F6O and a molecular weight of 524.59 g/mol. Its IUPAC name is 6,8-difluoro-7-[3-fluoro-4-(trifluoromethoxy)phenyl]-3-[2-(4-pentylcyclohexyl)ethyl]-1,2-dihydronaphthalene.
| Compound Name | 6,8-difluoro-7-[3-fluoro-4-(trifluoromethoxy)phenyl]-3-[2-(4-pentylcyclohexyl)ethyl]-1,2-dihydronaphthalene |
|---|---|
| PubChem CID | 139952091 |
| Molecular Formula | C30H34F6O |
| Molecular Weight | 524.59 g/mol |
| Exact Mass | 524.25 |
| IUPAC Name | 6,8-difluoro-7-[3-fluoro-4-(trifluoromethoxy)phenyl]-3-[2-(4-pentylcyclohexyl)ethyl]-1,2-dihydronaphthalene |
| SMILES | CCCCCC1CCC(CCC2=Cc3cc(F)c(-c4ccc(OC(F)(F)F)c(F)c4)c(F)c3CC2)CC1 |
| InChI | InChI=1S/C30H34F6O/c1-2-3-4-5-19-6-8-20(9-7-19)10-11-21-12-14-24-23(16-21)18-26(32)28(29(24)33)22-13-15-27(25(31)17-22)37-30(34,35)36/h13,15-20H,2-12,14H2,1H3 |
| InChIKey | NPOBGFBFFSNDQQ-UHFFFAOYSA-N |
| XLogP | 10.17 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.59 |
| LogP ≤ 5 | 10.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|