C22H20F6O — CID 139952098
6,8-difluoro-7-[3-fluoro-4-(trifluoromethoxy)phenyl]-3-pentyl-1,2-dihydronaphthalene (PubChem CID 139952098) has the molecular formula C22H20F6O and a molecular weight of 414.39 g/mol. Its IUPAC name is 6,8-difluoro-7-[3-fluoro-4-(trifluoromethoxy)phenyl]-3-pentyl-1,2-dihydronaphthalene.
| Compound Name | 6,8-difluoro-7-[3-fluoro-4-(trifluoromethoxy)phenyl]-3-pentyl-1,2-dihydronaphthalene |
|---|---|
| PubChem CID | 139952098 |
| Molecular Formula | C22H20F6O |
| Molecular Weight | 414.39 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | 6,8-difluoro-7-[3-fluoro-4-(trifluoromethoxy)phenyl]-3-pentyl-1,2-dihydronaphthalene |
| SMILES | CCCCCC1=Cc2cc(F)c(-c3ccc(OC(F)(F)F)c(F)c3)c(F)c2CC1 |
| InChI | InChI=1S/C22H20F6O/c1-2-3-4-5-13-6-8-16-15(10-13)12-18(24)20(21(16)25)14-7-9-19(17(23)11-14)29-22(26,27)28/h7,9-12H,2-6,8H2,1H3 |
| InChIKey | ABBIBTRFWYGTEV-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.39 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|