C23H23F5 — CID 139952245
6,8-difluoro-3-heptyl-7-(3,4,5-trifluorophenyl)-1,2-dihydronaphthalene (PubChem CID 139952245) has the molecular formula C23H23F5 and a molecular weight of 394.43 g/mol. Its IUPAC name is 6,8-difluoro-3-heptyl-7-(3,4,5-trifluorophenyl)-1,2-dihydronaphthalene.
| Compound Name | 6,8-difluoro-3-heptyl-7-(3,4,5-trifluorophenyl)-1,2-dihydronaphthalene |
|---|---|
| PubChem CID | 139952245 |
| Molecular Formula | C23H23F5 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | 6,8-difluoro-3-heptyl-7-(3,4,5-trifluorophenyl)-1,2-dihydronaphthalene |
| SMILES | CCCCCCCC1=Cc2cc(F)c(-c3cc(F)c(F)c(F)c3)c(F)c2CC1 |
| InChI | InChI=1S/C23H23F5/c1-2-3-4-5-6-7-14-8-9-17-15(10-14)11-18(24)21(22(17)27)16-12-19(25)23(28)20(26)13-16/h10-13H,2-9H2,1H3 |
| InChIKey | YZACWAUGRPHHBB-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|