C31H36F6O — CID 139960524
7-[3,5-difluoro-4-(trifluoromethoxy)phenyl]-8-fluoro-3-[2-(4-hexylcyclohexyl)ethyl]-1,2-dihydronaphthalene (PubChem CID 139960524) has the molecular formula C31H36F6O and a molecular weight of 538.62 g/mol. Its IUPAC name is 7-[3,5-difluoro-4-(trifluoromethoxy)phenyl]-8-fluoro-3-[2-(4-hexylcyclohexyl)ethyl]-1,2-dihydronaphthalene.
| Compound Name | 7-[3,5-difluoro-4-(trifluoromethoxy)phenyl]-8-fluoro-3-[2-(4-hexylcyclohexyl)ethyl]-1,2-dihydronaphthalene |
|---|---|
| PubChem CID | 139960524 |
| Molecular Formula | C31H36F6O |
| Molecular Weight | 538.62 g/mol |
| Exact Mass | 538.27 |
| IUPAC Name | 7-[3,5-difluoro-4-(trifluoromethoxy)phenyl]-8-fluoro-3-[2-(4-hexylcyclohexyl)ethyl]-1,2-dihydronaphthalene |
| SMILES | CCCCCCC1CCC(CCC2=Cc3ccc(-c4cc(F)c(OC(F)(F)F)c(F)c4)c(F)c3CC2)CC1 |
| InChI | InChI=1S/C31H36F6O/c1-2-3-4-5-6-20-7-9-21(10-8-20)11-12-22-13-15-25-23(17-22)14-16-26(29(25)34)24-18-27(32)30(28(33)19-24)38-31(35,36)37/h14,16-21H,2-13,15H2,1H3 |
| InChIKey | IRJCDKCXMNJRNA-UHFFFAOYSA-N |
| XLogP | 10.56 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.62 |
| LogP ≤ 5 | 10.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|