C19H24F2 — CID 139961519
6,7-difluoro-2-(4-propylcyclohexyl)-1,4-dihydronaphthalene (PubChem CID 139961519) has the molecular formula C19H24F2 and a molecular weight of 290.40 g/mol. Its IUPAC name is 6,7-difluoro-2-(4-propylcyclohexyl)-1,4-dihydronaphthalene.
| Compound Name | 6,7-difluoro-2-(4-propylcyclohexyl)-1,4-dihydronaphthalene |
|---|---|
| PubChem CID | 139961519 |
| Molecular Formula | C19H24F2 |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.18 |
| IUPAC Name | 6,7-difluoro-2-(4-propylcyclohexyl)-1,4-dihydronaphthalene |
| SMILES | CCCC1CCC(C2=CCc3cc(F)c(F)cc3C2)CC1 |
| InChI | InChI=1S/C19H24F2/c1-2-3-13-4-6-14(7-5-13)15-8-9-16-11-18(20)19(21)12-17(16)10-15/h8,11-14H,2-7,9-10H2,1H3 |
| InChIKey | FBTOETQSQBOPSK-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|