C25H19F9O3 — CID 173325759
4-[[3,5-difluoro-4-(trifluoromethoxy)phenoxy]-difluoromethyl]-3,5-difluoro-2-(4-pentylphenyl)phenol (PubChem CID 173325759) has the molecular formula C25H19F9O3 and a molecular weight of 538.41 g/mol. Its IUPAC name is 4-[[3,5-difluoro-4-(trifluoromethoxy)phenoxy]-difluoromethyl]-3,5-difluoro-2-(4-pentylphenyl)phenol.
| Compound Name | 4-[[3,5-difluoro-4-(trifluoromethoxy)phenoxy]-difluoromethyl]-3,5-difluoro-2-(4-pentylphenyl)phenol |
|---|---|
| PubChem CID | 173325759 |
| Molecular Formula | C25H19F9O3 |
| Molecular Weight | 538.41 g/mol |
| Exact Mass | 538.12 |
| IUPAC Name | 4-[[3,5-difluoro-4-(trifluoromethoxy)phenoxy]-difluoromethyl]-3,5-difluoro-2-(4-pentylphenyl)phenol |
| SMILES | CCCCCc1ccc(-c2c(O)cc(F)c(C(F)(F)Oc3cc(F)c(OC(F)(F)F)c(F)c3)c2F)cc1 |
| InChI | InChI=1S/C25H19F9O3/c1-2-3-4-5-13-6-8-14(9-7-13)20-19(35)12-16(26)21(22(20)29)24(30,31)36-15-10-17(27)23(18(28)11-15)37-25(32,33)34/h6-12,35H,2-5H2,1H3 |
| InChIKey | YNJMSFWEOZXYNR-UHFFFAOYSA-N |
| XLogP | 8.38 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.41 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|