C16H9F4NS — CID 170190197
[4-(4-cyclopropylphenyl)-2,3,5,6-tetrafluorophenyl] thiocyanate (PubChem CID 170190197) has the molecular formula C16H9F4NS and a molecular weight of 323.31 g/mol. Its IUPAC name is [4-(4-cyclopropylphenyl)-2,3,5,6-tetrafluorophenyl] thiocyanate.
| Compound Name | [4-(4-cyclopropylphenyl)-2,3,5,6-tetrafluorophenyl] thiocyanate |
|---|---|
| PubChem CID | 170190197 |
| Molecular Formula | C16H9F4NS |
| Molecular Weight | 323.31 g/mol |
| Exact Mass | 323.04 |
| IUPAC Name | [4-(4-cyclopropylphenyl)-2,3,5,6-tetrafluorophenyl] thiocyanate |
| SMILES | N#CSc1c(F)c(F)c(-c2ccc(C3CC3)cc2)c(F)c1F |
| InChI | InChI=1S/C16H9F4NS/c17-12-11(10-5-3-9(4-6-10)8-1-2-8)13(18)15(20)16(14(12)19)22-7-21/h3-6,8H,1-2H2 |
| InChIKey | POJIWUFGDZRYPA-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.31 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|