About phenyl N-(3-pyridin-2-yloxyphenyl)carbamate;3-pyridin-2-yloxyaniline
phenyl N-(3-pyridin-2-yloxyphenyl)carbamate;3-pyridin-2-yloxyaniline (PubChem CID 167710607) has the molecular formula C29H24N4O4
and a molecular weight of 492.54 g/mol. Its IUPAC name is phenyl N-(3-pyridin-2-yloxyphenyl)carbamate;3-pyridin-2-yloxyaniline.
Molecular Properties
| Compound Name | phenyl N-(3-pyridin-2-yloxyphenyl)carbamate;3-pyridin-2-yloxyaniline |
| PubChem CID | 167710607 |
| Molecular Formula | C29H24N4O4 |
| Molecular Weight | 492.54 g/mol |
| Exact Mass | 492.18 |
| IUPAC Name | phenyl N-(3-pyridin-2-yloxyphenyl)carbamate;3-pyridin-2-yloxyaniline |
| SMILES | Nc1cccc(Oc2ccccn2)c1.O=C(Nc1cccc(Oc2ccccn2)c1)Oc1ccccc1 |
| InChI | InChI=1S/C18H14N2O3.C11H10N2O/c21-18(23-15-8-2-1-3-9-15)20-14-7-6-10-16(13-14)22-17-11-4-5-12-19-17;12-9-4-3-5-10(8-9)14-11-6-1-2-7-13-11/h1-13H,(H,20,21);1-8H,12H2 |
| InChIKey | ZTYGCVJGZQKSRM-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 108.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 492.54 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze phenyl N-(3-pyridin-2-yloxyphenyl)carbamate;3-pyridin-2-yloxyaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl N-(3-pyridin-2-yloxyphenyl)carbamate;3-pyridin-2-yloxyaniline?
The IUPAC name of phenyl N-(3-pyridin-2-yloxyphenyl)carbamate;3-pyridin-2-yloxyaniline (CID 167710607) is phenyl N-(3-pyridin-2-yloxyphenyl)carbamate;3-pyridin-2-yloxyaniline.
What is the SMILES notation for phenyl N-(3-pyridin-2-yloxyphenyl)carbamate;3-pyridin-2-yloxyaniline?
The canonical SMILES for phenyl N-(3-pyridin-2-yloxyphenyl)carbamate;3-pyridin-2-yloxyaniline is Nc1cccc(Oc2ccccn2)c1.O=C(Nc1cccc(Oc2ccccn2)c1)Oc1ccccc1.
What is the InChIKey of phenyl N-(3-pyridin-2-yloxyphenyl)carbamate;3-pyridin-2-yloxyaniline?
The InChIKey is ZTYGCVJGZQKSRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14N2O3.C11H10N2O/c21-18(23-15-8-2-1-3-9-15)20-14-7-6-10-16(13-14)22-17-11-4-5-12-19-17;12-9-4-3-5-10(8-9)14-11-6-1-2-7-13-11/h1-13H,(H,20,21);1-8H,12H2.
What are the key properties of phenyl N-(3-pyridin-2-yloxyphenyl)carbamate;3-pyridin-2-yloxyaniline?
phenyl N-(3-pyridin-2-yloxyphenyl)carbamate;3-pyridin-2-yloxyaniline has a molecular weight of 492.54 g/mol, XLogP of 6.94, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl N-(3-pyridin-2-yloxyphenyl)carbamate;3-pyridin-2-yloxyaniline is sourced from PubChem (CID 167710607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).