C10H11N3O4S — CID 113344019
methyl N-[(3-cyanophenyl)methylsulfamoyl]carbamate (PubChem CID 113344019) has the molecular formula C10H11N3O4S and a molecular weight of 269.28 g/mol. Its IUPAC name is methyl N-[(3-cyanophenyl)methylsulfamoyl]carbamate.
| Compound Name | methyl N-[(3-cyanophenyl)methylsulfamoyl]carbamate |
|---|---|
| PubChem CID | 113344019 |
| Molecular Formula | C10H11N3O4S |
| Molecular Weight | 269.28 g/mol |
| Exact Mass | 269.05 |
| IUPAC Name | methyl N-[(3-cyanophenyl)methylsulfamoyl]carbamate |
| SMILES | COC(=O)NS(=O)(=O)NCc1cccc(C#N)c1 |
| InChI | InChI=1S/C10H11N3O4S/c1-17-10(14)13-18(15,16)12-7-9-4-2-3-8(5-9)6-11/h2-5,12H,7H2,1H3,(H,13,14) |
| InChIKey | QDOCMWBSJAVEER-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 108.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.28 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |