C13H15NO4S — CID 82178719
methyl 4-[(3-cyanophenyl)methylsulfonyl]butanoate (PubChem CID 82178719) has the molecular formula C13H15NO4S and a molecular weight of 281.33 g/mol. Its IUPAC name is methyl 4-[(3-cyanophenyl)methylsulfonyl]butanoate.
| Compound Name | methyl 4-[(3-cyanophenyl)methylsulfonyl]butanoate |
|---|---|
| PubChem CID | 82178719 |
| Molecular Formula | C13H15NO4S |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | methyl 4-[(3-cyanophenyl)methylsulfonyl]butanoate |
| SMILES | COC(=O)CCCS(=O)(=O)Cc1cccc(C#N)c1 |
| InChI | InChI=1S/C13H15NO4S/c1-18-13(15)6-3-7-19(16,17)10-12-5-2-4-11(8-12)9-14/h2,4-5,8H,3,6-7,10H2,1H3 |
| InChIKey | KBGCSHJRQRVONO-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 84.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |