C12H16N2O3S — CID 55153232
N-[(3-cyanophenyl)methyl]-2-methoxy-N-methylethanesulfonamide (PubChem CID 55153232) has the molecular formula C12H16N2O3S and a molecular weight of 268.34 g/mol. Its IUPAC name is N-[(3-cyanophenyl)methyl]-2-methoxy-N-methylethanesulfonamide.
| Compound Name | N-[(3-cyanophenyl)methyl]-2-methoxy-N-methylethanesulfonamide |
|---|---|
| PubChem CID | 55153232 |
| Molecular Formula | C12H16N2O3S |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | N-[(3-cyanophenyl)methyl]-2-methoxy-N-methylethanesulfonamide |
| SMILES | COCCS(=O)(=O)N(C)Cc1cccc(C#N)c1 |
| InChI | InChI=1S/C12H16N2O3S/c1-14(18(15,16)7-6-17-2)10-12-5-3-4-11(8-12)9-13/h3-5,8H,6-7,10H2,1-2H3 |
| InChIKey | GVEUSMGGUXHJII-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |