C15H21N3O2 — CID 81083572
2-amino-N-[(3-cyanophenyl)methyl]-5-methoxy-N-methylpentanamide (PubChem CID 81083572) has the molecular formula C15H21N3O2 and a molecular weight of 275.35 g/mol. Its IUPAC name is 2-amino-N-[(3-cyanophenyl)methyl]-5-methoxy-N-methylpentanamide.
| Compound Name | 2-amino-N-[(3-cyanophenyl)methyl]-5-methoxy-N-methylpentanamide |
|---|---|
| PubChem CID | 81083572 |
| Molecular Formula | C15H21N3O2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | 2-amino-N-[(3-cyanophenyl)methyl]-5-methoxy-N-methylpentanamide |
| SMILES | COCCCC(N)C(=O)N(C)Cc1cccc(C#N)c1 |
| InChI | InChI=1S/C15H21N3O2/c1-18(15(19)14(17)7-4-8-20-2)11-13-6-3-5-12(9-13)10-16/h3,5-6,9,14H,4,7-8,11,17H2,1-2H3 |
| InChIKey | PXZQIPUWOAXZEY-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 79.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|