C15H21N3O — CID 65230274
2-(aminomethyl)-N-[(3-cyanophenyl)methyl]-N-methylpentanamide (PubChem CID 65230274) has the molecular formula C15H21N3O and a molecular weight of 259.35 g/mol. Its IUPAC name is 2-(aminomethyl)-N-[(3-cyanophenyl)methyl]-N-methylpentanamide.
| Compound Name | 2-(aminomethyl)-N-[(3-cyanophenyl)methyl]-N-methylpentanamide |
|---|---|
| PubChem CID | 65230274 |
| Molecular Formula | C15H21N3O |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | 2-(aminomethyl)-N-[(3-cyanophenyl)methyl]-N-methylpentanamide |
| SMILES | CCCC(CN)C(=O)N(C)Cc1cccc(C#N)c1 |
| InChI | InChI=1S/C15H21N3O/c1-3-5-14(10-17)15(19)18(2)11-13-7-4-6-12(8-13)9-16/h4,6-8,14H,3,5,10-11,17H2,1-2H3 |
| InChIKey | HPBLPJLMMGITQX-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 70.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |