C14H22N4O2S — CID 66000148
6-amino-N-[3-(dimethylamino)propyl]-N-methyl-1H-indole-3-sulfonamide (PubChem CID 66000148) has the molecular formula C14H22N4O2S and a molecular weight of 310.42 g/mol. Its IUPAC name is 6-amino-N-[3-(dimethylamino)propyl]-N-methyl-1H-indole-3-sulfonamide.
| Compound Name | 6-amino-N-[3-(dimethylamino)propyl]-N-methyl-1H-indole-3-sulfonamide |
|---|---|
| PubChem CID | 66000148 |
| Molecular Formula | C14H22N4O2S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | 6-amino-N-[3-(dimethylamino)propyl]-N-methyl-1H-indole-3-sulfonamide |
| SMILES | CN(C)CCCN(C)S(=O)(=O)c1c[nH]c2cc(N)ccc12 |
| InChI | InChI=1S/C14H22N4O2S/c1-17(2)7-4-8-18(3)21(19,20)14-10-16-13-9-11(15)5-6-12(13)14/h5-6,9-10,16H,4,7-8,15H2,1-3H3 |
| InChIKey | VTMAJJFJXICLCX-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|