C11H12F3N3O2S — CID 64853040
5-amino-N-methyl-N-(2,2,2-trifluoroethyl)-1H-indole-3-sulfonamide (PubChem CID 64853040) has the molecular formula C11H12F3N3O2S and a molecular weight of 307.30 g/mol. Its IUPAC name is 5-amino-N-methyl-N-(2,2,2-trifluoroethyl)-1H-indole-3-sulfonamide.
| Compound Name | 5-amino-N-methyl-N-(2,2,2-trifluoroethyl)-1H-indole-3-sulfonamide |
|---|---|
| PubChem CID | 64853040 |
| Molecular Formula | C11H12F3N3O2S |
| Molecular Weight | 307.30 g/mol |
| Exact Mass | 307.06 |
| IUPAC Name | 5-amino-N-methyl-N-(2,2,2-trifluoroethyl)-1H-indole-3-sulfonamide |
| SMILES | CN(CC(F)(F)F)S(=O)(=O)c1c[nH]c2ccc(N)cc12 |
| InChI | InChI=1S/C11H12F3N3O2S/c1-17(6-11(12,13)14)20(18,19)10-5-16-9-3-2-7(15)4-8(9)10/h2-5,16H,6,15H2,1H3 |
| InChIKey | ANWGMFTXBRBRJM-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.30 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|