C10H13F3N2O2S — CID 60892303
5-amino-N,2-dimethyl-N-(2,2,2-trifluoroethyl)benzenesulfonamide (PubChem CID 60892303) has the molecular formula C10H13F3N2O2S and a molecular weight of 282.29 g/mol. Its IUPAC name is 5-amino-N,2-dimethyl-N-(2,2,2-trifluoroethyl)benzenesulfonamide.
| Compound Name | 5-amino-N,2-dimethyl-N-(2,2,2-trifluoroethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 60892303 |
| Molecular Formula | C10H13F3N2O2S |
| Molecular Weight | 282.29 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | 5-amino-N,2-dimethyl-N-(2,2,2-trifluoroethyl)benzenesulfonamide |
| SMILES | Cc1ccc(N)cc1S(=O)(=O)N(C)CC(F)(F)F |
| InChI | InChI=1S/C10H13F3N2O2S/c1-7-3-4-8(14)5-9(7)18(16,17)15(2)6-10(11,12)13/h3-5H,6,14H2,1-2H3 |
| InChIKey | HHPKWBVXDSDTDF-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.29 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|