C14H21N3O2S — CID 64850889
5-amino-N-butyl-N-ethyl-1H-indole-3-sulfonamide (PubChem CID 64850889) has the molecular formula C14H21N3O2S and a molecular weight of 295.41 g/mol. Its IUPAC name is 5-amino-N-butyl-N-ethyl-1H-indole-3-sulfonamide.
| Compound Name | 5-amino-N-butyl-N-ethyl-1H-indole-3-sulfonamide |
|---|---|
| PubChem CID | 64850889 |
| Molecular Formula | C14H21N3O2S |
| Molecular Weight | 295.41 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | 5-amino-N-butyl-N-ethyl-1H-indole-3-sulfonamide |
| SMILES | CCCCN(CC)S(=O)(=O)c1c[nH]c2ccc(N)cc12 |
| InChI | InChI=1S/C14H21N3O2S/c1-3-5-8-17(4-2)20(18,19)14-10-16-13-7-6-11(15)9-12(13)14/h6-7,9-10,16H,3-5,8,15H2,1-2H3 |
| InChIKey | MMVCKYDYLPTWHG-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.41 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|