C11H21N5O2S — CID 63700254
N-[3-(dimethylamino)propyl]-2-hydrazinyl-N-methylpyridine-3-sulfonamide (PubChem CID 63700254) has the molecular formula C11H21N5O2S and a molecular weight of 287.39 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-2-hydrazinyl-N-methylpyridine-3-sulfonamide.
| Compound Name | N-[3-(dimethylamino)propyl]-2-hydrazinyl-N-methylpyridine-3-sulfonamide |
|---|---|
| PubChem CID | 63700254 |
| Molecular Formula | C11H21N5O2S |
| Molecular Weight | 287.39 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-2-hydrazinyl-N-methylpyridine-3-sulfonamide |
| SMILES | CN(C)CCCN(C)S(=O)(=O)c1cccnc1NN |
| InChI | InChI=1S/C11H21N5O2S/c1-15(2)8-5-9-16(3)19(17,18)10-6-4-7-13-11(10)14-12/h4,6-7H,5,8-9,12H2,1-3H3,(H,13,14) |
| InChIKey | MTADIHJYBDAWMB-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.39 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|