C12H22N4O2S — CID 103306050
N-[3-(dimethylamino)propyl]-N-methyl-3-(methylamino)pyridine-2-sulfonamide (PubChem CID 103306050) has the molecular formula C12H22N4O2S and a molecular weight of 286.40 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-N-methyl-3-(methylamino)pyridine-2-sulfonamide.
| Compound Name | N-[3-(dimethylamino)propyl]-N-methyl-3-(methylamino)pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 103306050 |
| Molecular Formula | C12H22N4O2S |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-N-methyl-3-(methylamino)pyridine-2-sulfonamide |
| SMILES | CNc1cccnc1S(=O)(=O)N(C)CCCN(C)C |
| InChI | InChI=1S/C12H22N4O2S/c1-13-11-7-5-8-14-12(11)19(17,18)16(4)10-6-9-15(2)3/h5,7-8,13H,6,9-10H2,1-4H3 |
| InChIKey | BTBHSPAXSXJWPL-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |