C11H19N3O4S — CID 103305649
N-(2-hydroxy-3-methoxypropyl)-N-methyl-3-(methylamino)pyridine-2-sulfonamide (PubChem CID 103305649) has the molecular formula C11H19N3O4S and a molecular weight of 289.36 g/mol. Its IUPAC name is N-(2-hydroxy-3-methoxypropyl)-N-methyl-3-(methylamino)pyridine-2-sulfonamide.
| Compound Name | N-(2-hydroxy-3-methoxypropyl)-N-methyl-3-(methylamino)pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 103305649 |
| Molecular Formula | C11H19N3O4S |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | N-(2-hydroxy-3-methoxypropyl)-N-methyl-3-(methylamino)pyridine-2-sulfonamide |
| SMILES | CNc1cccnc1S(=O)(=O)N(C)CC(O)COC |
| InChI | InChI=1S/C11H19N3O4S/c1-12-10-5-4-6-13-11(10)19(16,17)14(2)7-9(15)8-18-3/h4-6,9,12,15H,7-8H2,1-3H3 |
| InChIKey | UKPCKIXKVUEJQT-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |