C11H20N4O4S — CID 61418313
2-hydrazinyl-N,N-bis(2-methoxyethyl)pyridine-3-sulfonamide (PubChem CID 61418313) has the molecular formula C11H20N4O4S and a molecular weight of 304.37 g/mol. Its IUPAC name is 2-hydrazinyl-N,N-bis(2-methoxyethyl)pyridine-3-sulfonamide.
| Compound Name | 2-hydrazinyl-N,N-bis(2-methoxyethyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 61418313 |
| Molecular Formula | C11H20N4O4S |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 2-hydrazinyl-N,N-bis(2-methoxyethyl)pyridine-3-sulfonamide |
| SMILES | COCCN(CCOC)S(=O)(=O)c1cccnc1NN |
| InChI | InChI=1S/C11H20N4O4S/c1-18-8-6-15(7-9-19-2)20(16,17)10-4-3-5-13-11(10)14-12/h3-5H,6-9,12H2,1-2H3,(H,13,14) |
| InChIKey | SRUZRLHCDZJGTN-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 106.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|