C13H22ClN3O3S — CID 61046666
2-chloro-N-[3-(dimethylamino)propyl]-N-(2-methoxyethyl)pyridine-3-sulfonamide (PubChem CID 61046666) has the molecular formula C13H22ClN3O3S and a molecular weight of 335.86 g/mol. Its IUPAC name is 2-chloro-N-[3-(dimethylamino)propyl]-N-(2-methoxyethyl)pyridine-3-sulfonamide.
| Compound Name | 2-chloro-N-[3-(dimethylamino)propyl]-N-(2-methoxyethyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 61046666 |
| Molecular Formula | C13H22ClN3O3S |
| Molecular Weight | 335.86 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | 2-chloro-N-[3-(dimethylamino)propyl]-N-(2-methoxyethyl)pyridine-3-sulfonamide |
| SMILES | COCCN(CCCN(C)C)S(=O)(=O)c1cccnc1Cl |
| InChI | InChI=1S/C13H22ClN3O3S/c1-16(2)8-5-9-17(10-11-20-3)21(18,19)12-6-4-7-15-13(12)14/h4,6-7H,5,8-11H2,1-3H3 |
| InChIKey | QAHUZISIJSLDDX-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.86 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|