C26H24Cl3N3O6S2 — CID 158526990
2-chloro-N,N-bis[(4-methoxyphenyl)methyl]pyridine-3-sulfonamide;2-chloropyridine-3-sulfonyl chloride (PubChem CID 158526990) has the molecular formula C26H24Cl3N3O6S2 and a molecular weight of 644.99 g/mol. Its IUPAC name is 2-chloro-N,N-bis[(4-methoxyphenyl)methyl]pyridine-3-sulfonamide;2-chloropyridine-3-sulfonyl chloride.
| Compound Name | 2-chloro-N,N-bis[(4-methoxyphenyl)methyl]pyridine-3-sulfonamide;2-chloropyridine-3-sulfonyl chloride |
|---|---|
| PubChem CID | 158526990 |
| Molecular Formula | C26H24Cl3N3O6S2 |
| Molecular Weight | 644.99 g/mol |
| Exact Mass | 643.02 |
| IUPAC Name | 2-chloro-N,N-bis[(4-methoxyphenyl)methyl]pyridine-3-sulfonamide;2-chloropyridine-3-sulfonyl chloride |
| SMILES | COc1ccc(CN(Cc2ccc(OC)cc2)S(=O)(=O)c2cccnc2Cl)cc1.O=S(=O)(Cl)c1cccnc1Cl |
| InChI | InChI=1S/C21H21ClN2O4S.C5H3Cl2NO2S/c1-27-18-9-5-16(6-10-18)14-24(15-17-7-11-19(28-2)12-8-17)29(25,26)20-4-3-13-23-21(20)22;6-5-4(11(7,9)10)2-1-3-8-5/h3-13H,14-15H2,1-2H3;1-3H |
| InChIKey | HMXBZQZPGJBWCN-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 115.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.99 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|