C31H32BN5O7S — CID 140751938
[3-[bis[(4-methoxyphenyl)methyl]sulfamoyl]-2-[2-[(4-methoxyphenyl)methyl]tetrazol-5-yl]phenyl]boronic acid (PubChem CID 140751938) has the molecular formula C31H32BN5O7S and a molecular weight of 629.50 g/mol. Its IUPAC name is [3-[bis[(4-methoxyphenyl)methyl]sulfamoyl]-2-[2-[(4-methoxyphenyl)methyl]tetrazol-5-yl]phenyl]boronic acid.
| Compound Name | [3-[bis[(4-methoxyphenyl)methyl]sulfamoyl]-2-[2-[(4-methoxyphenyl)methyl]tetrazol-5-yl]phenyl]boronic acid |
|---|---|
| PubChem CID | 140751938 |
| Molecular Formula | C31H32BN5O7S |
| Molecular Weight | 629.50 g/mol |
| Exact Mass | 629.21 |
| IUPAC Name | [3-[bis[(4-methoxyphenyl)methyl]sulfamoyl]-2-[2-[(4-methoxyphenyl)methyl]tetrazol-5-yl]phenyl]boronic acid |
| SMILES | COc1ccc(CN(Cc2ccc(OC)cc2)S(=O)(=O)c2cccc(B(O)O)c2-c2nnn(Cc3ccc(OC)cc3)n2)cc1 |
| InChI | InChI=1S/C31H32BN5O7S/c1-42-25-13-7-22(8-14-25)19-36(20-23-9-15-26(43-2)16-10-23)45(40,41)29-6-4-5-28(32(38)39)30(29)31-33-35-37(34-31)21-24-11-17-27(44-3)18-12-24/h4-18,38-39H,19-21H2,1-3H3 |
| InChIKey | JPQKAVUHAJAZEK-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 149.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.50 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|