C40H39N11O5S — CID 122687988
3-[4-(1,3-diazidopropan-2-yl)phenyl]-N,N-bis[(4-methoxyphenyl)methyl]-2-[2-[(4-methoxyphenyl)methyl]tetrazol-5-yl]benzenesulfonamide (PubChem CID 122687988) has the molecular formula C40H39N11O5S and a molecular weight of 785.89 g/mol. Its IUPAC name is 3-[4-(1,3-diazidopropan-2-yl)phenyl]-N,N-bis[(4-methoxyphenyl)methyl]-2-[2-[(4-methoxyphenyl)methyl]tetrazol-5-yl]benzenesulfonamide.
| Compound Name | 3-[4-(1,3-diazidopropan-2-yl)phenyl]-N,N-bis[(4-methoxyphenyl)methyl]-2-[2-[(4-methoxyphenyl)methyl]tetrazol-5-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 122687988 |
| Molecular Formula | C40H39N11O5S |
| Molecular Weight | 785.89 g/mol |
| Exact Mass | 785.29 |
| IUPAC Name | 3-[4-(1,3-diazidopropan-2-yl)phenyl]-N,N-bis[(4-methoxyphenyl)methyl]-2-[2-[(4-methoxyphenyl)methyl]tetrazol-5-yl]benzenesulfonamide |
| SMILES | COc1ccc(CN(Cc2ccc(OC)cc2)S(=O)(=O)c2cccc(-c3ccc(C(CN=[N+]=[N-])CN=[N+]=[N-])cc3)c2-c2nnn(Cc3ccc(OC)cc3)n2)cc1 |
| InChI | InChI=1S/C40H39N11O5S/c1-54-34-17-7-28(8-18-34)25-50(26-29-9-19-35(55-2)20-10-29)57(52,53)38-6-4-5-37(32-15-13-31(14-16-32)33(23-43-47-41)24-44-48-42)39(38)40-45-49-51(46-40)27-30-11-21-36(56-3)22-12-30/h4-22,33H,23-27H2,1-3H3 |
| InChIKey | QHIYMXYELKKEJO-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 206.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 785.89 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|